Carboxylic acids and derivatives
Filtered Search Results
Ethylenediaminetetraacetic Acid Disodium Salt Dihydrate, ≥99%, Molecular Biology Reagent Grade, MP Biomedicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Diethyl maleate, 97%
CAS: 141-05-9 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00009191 InChI Key: IEPRKVQEAMIZSS-WAYWQWQTSA-N Synonym: diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 PubChem CID: 5271566 ChEBI: CHEBI:68508 IUPAC Name: diethyl (Z)-but-2-enedioate SMILES: CCOC(=O)C=CC(=O)OCC
| PubChem CID | 5271566 |
|---|---|
| CAS | 141-05-9 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:68508 |
| MDL Number | MFCD00009191 |
| SMILES | CCOC(=O)C=CC(=O)OCC |
| Synonym | diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 |
| IUPAC Name | diethyl (Z)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-WAYWQWQTSA-N |
| Molecular Formula | C8H12O4 |
4-Methylvaleric acid, 99%
CAS: 646-07-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002803 InChI Key: FGKJLKRYENPLQH-UHFFFAOYSA-N Synonym: 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid PubChem CID: 12587 ChEBI: CHEBI:74903 IUPAC Name: 4-methylpentanoic acid SMILES: CC(C)CCC(=O)O
| PubChem CID | 12587 |
|---|---|
| CAS | 646-07-1 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:74903 |
| MDL Number | MFCD00002803 |
| SMILES | CC(C)CCC(=O)O |
| Synonym | 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid |
| IUPAC Name | 4-methylpentanoic acid |
| InChI Key | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab.
CAS: 355-93-1 Molecular Formula: C9H8F8O2 Molecular Weight (g/mol): 300.15 MDL Number: MFCD00039278 InChI Key: ZNJXRXXJPIFFAO-UHFFFAOYSA-N Synonym: 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate PubChem CID: 67739 IUPAC Name: 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F
| PubChem CID | 67739 |
|---|---|
| CAS | 355-93-1 |
| Molecular Weight (g/mol) | 300.15 |
| MDL Number | MFCD00039278 |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Synonym | 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| InChI Key | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| Molecular Formula | C9H8F8O2 |
Syringic acid, 97%
CAS: 530-57-4 Molecular Formula: C9H10O5 Molecular Weight (g/mol): 198.17 MDL Number: MFCD00002552 InChI Key: JMSVCTWVEWCHDZ-UHFFFAOYSA-N Synonym: syringic acid,3,5-dimethoxy-4-hydroxybenzoic acid,cedar acid,gallic acid 3,5-dimethyl ether,benzoic acid, 4-hydroxy-3,5-dimethoxy,3,5-dimethoxy-4-hydroxybenzyl acid,4-hydroxy-3,5-dimethoxy-benzoic acid,chembl1414,syringicacid,syringlicacid PubChem CID: 10742 ChEBI: CHEBI:68329 IUPAC Name: 4-hydroxy-3,5-dimethoxybenzoic acid SMILES: COC1=CC(=CC(OC)=C1O)C(O)=O
| PubChem CID | 10742 |
|---|---|
| CAS | 530-57-4 |
| Molecular Weight (g/mol) | 198.17 |
| ChEBI | CHEBI:68329 |
| MDL Number | MFCD00002552 |
| SMILES | COC1=CC(=CC(OC)=C1O)C(O)=O |
| Synonym | syringic acid,3,5-dimethoxy-4-hydroxybenzoic acid,cedar acid,gallic acid 3,5-dimethyl ether,benzoic acid, 4-hydroxy-3,5-dimethoxy,3,5-dimethoxy-4-hydroxybenzyl acid,4-hydroxy-3,5-dimethoxy-benzoic acid,chembl1414,syringicacid,syringlicacid |
| IUPAC Name | 4-hydroxy-3,5-dimethoxybenzoic acid |
| InChI Key | JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O5 |
Dibutyl maleate, 97%
CAS: 105-76-0 Molecular Formula: C12H20O4 Molecular Weight (g/mol): 228.29 MDL Number: MFCD00009447,MFCD00065141 InChI Key: JBSLOWBPDRZSMB-FPLPWBNLSA-N Synonym: dibutyl maleate,butyl maleate,staflex dbm,rc comonomer dbm,maleic acid, dibutyl ester,di-n-butyl maleate,2-butenedioic acid z-, dibutyl ester,2-butenedioic acid, dibutyl ester,maleic acid dibutyl ester,2-butenedioic acid 2z-, dibutyl ester PubChem CID: 5271569 IUPAC Name: dibutyl (Z)-but-2-enedioate SMILES: CCCCOC(=O)\C=C/C(=O)OCCCC
| PubChem CID | 5271569 |
|---|---|
| CAS | 105-76-0 |
| Molecular Weight (g/mol) | 228.29 |
| MDL Number | MFCD00009447,MFCD00065141 |
| SMILES | CCCCOC(=O)\C=C/C(=O)OCCCC |
| Synonym | dibutyl maleate,butyl maleate,staflex dbm,rc comonomer dbm,maleic acid, dibutyl ester,di-n-butyl maleate,2-butenedioic acid z-, dibutyl ester,2-butenedioic acid, dibutyl ester,maleic acid dibutyl ester,2-butenedioic acid 2z-, dibutyl ester |
| IUPAC Name | dibutyl (Z)-but-2-enedioate |
| InChI Key | JBSLOWBPDRZSMB-FPLPWBNLSA-N |
| Molecular Formula | C12H20O4 |
n-Butyl levulinate, 98%
CAS: 2052-15-5 Molecular Formula: C9H16O3 Molecular Weight (g/mol): 172.224 MDL Number: MFCD00009449 InChI Key: ISBWNEKJSSLXOD-UHFFFAOYSA-N Synonym: butyl levulinate,n-butyl levulinate,butyl laevulinate,pentanoic acid, 4-oxo-, butyl ester,n-butyl laevulinate,levulinic acid, butyl ester,butyl 4-ketovalerate,4-ketopentanoic acid butyl ester,butyl acetylpropionate,n-butyl 4-oxopentanoate PubChem CID: 16331 IUPAC Name: butyl 4-oxopentanoate SMILES: CCCCOC(=O)CCC(=O)C
| PubChem CID | 16331 |
|---|---|
| CAS | 2052-15-5 |
| Molecular Weight (g/mol) | 172.224 |
| MDL Number | MFCD00009449 |
| SMILES | CCCCOC(=O)CCC(=O)C |
| Synonym | butyl levulinate,n-butyl levulinate,butyl laevulinate,pentanoic acid, 4-oxo-, butyl ester,n-butyl laevulinate,levulinic acid, butyl ester,butyl 4-ketovalerate,4-ketopentanoic acid butyl ester,butyl acetylpropionate,n-butyl 4-oxopentanoate |
| IUPAC Name | butyl 4-oxopentanoate |
| InChI Key | ISBWNEKJSSLXOD-UHFFFAOYSA-N |
| Molecular Formula | C9H16O3 |
1,3-Dibromo-5,5-dimethylhydantoin, 98%
CAS: 77-48-5 Molecular Formula: C5H6Br2N2O2 Molecular Weight (g/mol): 285.91 MDL Number: MFCD00003189 InChI Key: VRLDVERQJMEPIF-UHFFFAOYSA-N Synonym: 1,3-dibromo-5,5-dimethylhydantoin,dibromantin,dibromantine,take charge orange,dbdmh,n,n'-dibromodimethylhydantoin,5,5-dimethyl-1,3-dibromohydantoin,2,4-imidazolidinedione, 1,3-dibromo-5,5-dimethyl,1,3-dibromo-5,5-dimethyl-2,4-imidazolidinedione,unii-v9r5f9i7mz PubChem CID: 6479 IUPAC Name: 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione SMILES: CC1(C(=O)N(C(=O)N1Br)Br)C
| PubChem CID | 6479 |
|---|---|
| CAS | 77-48-5 |
| Molecular Weight (g/mol) | 285.91 |
| MDL Number | MFCD00003189 |
| SMILES | CC1(C(=O)N(C(=O)N1Br)Br)C |
| Synonym | 1,3-dibromo-5,5-dimethylhydantoin,dibromantin,dibromantine,take charge orange,dbdmh,n,n'-dibromodimethylhydantoin,5,5-dimethyl-1,3-dibromohydantoin,2,4-imidazolidinedione, 1,3-dibromo-5,5-dimethyl,1,3-dibromo-5,5-dimethyl-2,4-imidazolidinedione,unii-v9r5f9i7mz |
| IUPAC Name | 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione |
| InChI Key | VRLDVERQJMEPIF-UHFFFAOYSA-N |
| Molecular Formula | C5H6Br2N2O2 |
2-Iodoacetamide 98.0+%, TCI America™
CAS: 144-48-9 Molecular Formula: C2H4INO Molecular Weight (g/mol): 184.964 MDL Number: MFCD00008028 InChI Key: PGLTVOMIXTUURA-UHFFFAOYSA-N Synonym: iodoacetamide,monoiodoacetamide,surauto,acetamide, 2-iodo,2-iodo-acetamide,usaf d-1,alpha-iodoacetamide,ccris 7710,unii-zrh8m27s79,n-3-methoxy-4-butoxybenzyl thiobarbituric acid PubChem CID: 3727 IUPAC Name: 2-iodoacetamide SMILES: C(C(=O)N)I
| PubChem CID | 3727 |
|---|---|
| CAS | 144-48-9 |
| Molecular Weight (g/mol) | 184.964 |
| MDL Number | MFCD00008028 |
| SMILES | C(C(=O)N)I |
| Synonym | iodoacetamide,monoiodoacetamide,surauto,acetamide, 2-iodo,2-iodo-acetamide,usaf d-1,alpha-iodoacetamide,ccris 7710,unii-zrh8m27s79,n-3-methoxy-4-butoxybenzyl thiobarbituric acid |
| IUPAC Name | 2-iodoacetamide |
| InChI Key | PGLTVOMIXTUURA-UHFFFAOYSA-N |
| Molecular Formula | C2H4INO |
4'-Bromo-2'-chloroacetanilide, 98+%
CAS: 3460-23-9 Molecular Formula: C8H7BrClNO Molecular Weight (g/mol): 248.504 MDL Number: MFCD00040852 InChI Key: MITWNEIUIPGZKR-UHFFFAOYSA-N Synonym: 4'-bromo-2'-chloroacetanilide,n-4-bromo-2-chlorophenyl acetamide,4-bromo-2-chloroacetanilide,acetamide, n-4-bromo-2-chlorophenyl,maybridge3_007422,2-chlor-4-bromacetanilid,acmc-209i8u,buttpark 83\07-60,acetanilide, 4'-bromo-2'-chloro PubChem CID: 610167 IUPAC Name: N-(4-bromo-2-chlorophenyl)acetamide SMILES: CC(=O)NC1=C(C=C(C=C1)Br)Cl
| PubChem CID | 610167 |
|---|---|
| CAS | 3460-23-9 |
| Molecular Weight (g/mol) | 248.504 |
| MDL Number | MFCD00040852 |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)Cl |
| Synonym | 4'-bromo-2'-chloroacetanilide,n-4-bromo-2-chlorophenyl acetamide,4-bromo-2-chloroacetanilide,acetamide, n-4-bromo-2-chlorophenyl,maybridge3_007422,2-chlor-4-bromacetanilid,acmc-209i8u,buttpark 83\07-60,acetanilide, 4'-bromo-2'-chloro |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)acetamide |
| InChI Key | MITWNEIUIPGZKR-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrClNO |
Ethyl formate, 98+%, pure
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Citric acid diammonium salt, 99+%
CAS: 3012-65-5 Molecular Formula: C6H14N2O7 Molecular Weight (g/mol): 226.19 MDL Number: MFCD00013068 InChI Key: YXVFQADLFFNVDS-UHFFFAOYSA-N Synonym: ammonium citrate dibasic,ammonium hydrogencitrate,diammonium hydrogen citrate,citric acid diammonium salt,citric acid ammonium salt,di-ammonium hydrogen citrate,citro diamine,citric acid diamine,ammonium citrate, dibasic, acs,ammonium citrate dibasic, puriss PubChem CID: 13710713 ChEBI: CHEBI:63076 IUPAC Name: azane;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O
| PubChem CID | 13710713 |
|---|---|
| CAS | 3012-65-5 |
| Molecular Weight (g/mol) | 226.19 |
| ChEBI | CHEBI:63076 |
| MDL Number | MFCD00013068 |
| SMILES | [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O |
| Synonym | ammonium citrate dibasic,ammonium hydrogencitrate,diammonium hydrogen citrate,citric acid diammonium salt,citric acid ammonium salt,di-ammonium hydrogen citrate,citro diamine,citric acid diamine,ammonium citrate, dibasic, acs,ammonium citrate dibasic, puriss |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | YXVFQADLFFNVDS-UHFFFAOYSA-N |
| Molecular Formula | C6H14N2O7 |
N-Hydroxyphthalimide, 98%
CAS: 524-38-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00005891 InChI Key: CFMZSMGAMPBRBE-UHFFFAOYSA-N Synonym: n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione PubChem CID: 10665 IUPAC Name: 2-hydroxyisoindole-1,3-dione SMILES: ON1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 10665 |
|---|---|
| CAS | 524-38-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00005891 |
| SMILES | ON1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione |
| IUPAC Name | 2-hydroxyisoindole-1,3-dione |
| InChI Key | CFMZSMGAMPBRBE-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
Phthalimide, 99%
CAS: 85-41-6 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 MDL Number: MFCD00005881 InChI Key: XKJCHHZQLQNZHY-UHFFFAOYSA-N Synonym: phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid PubChem CID: 6809 ChEBI: CHEBI:38817 IUPAC Name: isoindole-1,3-dione SMILES: O=C1NC(=O)C2=CC=CC=C12
| PubChem CID | 6809 |
|---|---|
| CAS | 85-41-6 |
| Molecular Weight (g/mol) | 147.13 |
| ChEBI | CHEBI:38817 |
| MDL Number | MFCD00005881 |
| SMILES | O=C1NC(=O)C2=CC=CC=C12 |
| Synonym | phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid |
| IUPAC Name | isoindole-1,3-dione |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
Methyl isobutyrate, 99%
CAS: 547-63-7 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00008914 InChI Key: BHIWKHZACMWKOJ-UHFFFAOYSA-N Synonym: methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne PubChem CID: 11039 ChEBI: CHEBI:73689 IUPAC Name: methyl 2-methylpropanoate SMILES: CC(C)C(=O)OC
| PubChem CID | 11039 |
|---|---|
| CAS | 547-63-7 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:73689 |
| MDL Number | MFCD00008914 |
| SMILES | CC(C)C(=O)OC |
| Synonym | methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne |
| IUPAC Name | methyl 2-methylpropanoate |
| InChI Key | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |